C23H34BrN3O3 — CID 11059893
tert-butyl 4-[4-[(Z)-C-(4-bromophenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 11059893) has the molecular formula C23H34BrN3O3 and a molecular weight of 480.45 g/mol. Its IUPAC name is tert-butyl 4-[4-[(Z)-C-(4-bromophenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(Z)-C-(4-bromophenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11059893 |
| Molecular Formula | C23H34BrN3O3 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | tert-butyl 4-[4-[(Z)-C-(4-bromophenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(N2CCC(/C(=N/O)c3ccc(Br)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H34BrN3O3/c1-22(2,3)30-21(28)26-15-11-23(4,12-16-26)27-13-9-18(10-14-27)20(25-29)17-5-7-19(24)8-6-17/h5-8,18,29H,9-16H2,1-4H3/b25-20+ |
| InChIKey | ROIQQLLMMYXHRQ-LKUDQCMESA-N |
| XLogP | 5.13 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|