C30H37BrN4O2 — CID 11157318
[4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-methylindol-5-yl)methanone (PubChem CID 11157318) has the molecular formula C30H37BrN4O2 and a molecular weight of 565.56 g/mol. Its IUPAC name is [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-methylindol-5-yl)methanone.
| Compound Name | [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-methylindol-5-yl)methanone |
|---|---|
| PubChem CID | 11157318 |
| Molecular Formula | C30H37BrN4O2 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [4-[4-[(Z)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(1-methylindol-5-yl)methanone |
| SMILES | CCO/N=C(\c1ccc(Br)cc1)C1CCN(C2(C)CCN(C(=O)c3ccc4c(ccn4C)c3)CC2)CC1 |
| InChI | InChI=1S/C30H37BrN4O2/c1-4-37-32-28(22-5-8-26(31)9-6-22)23-12-17-35(18-13-23)30(2)14-19-34(20-15-30)29(36)25-7-10-27-24(21-25)11-16-33(27)3/h5-11,16,21,23H,4,12-15,17-20H2,1-3H3/b32-28+ |
| InChIKey | HUEPFACVFOTJFY-VEWQFJOQSA-N |
| XLogP | 6.09 |
| TPSA | 50.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|