C31H36BrClN4O2 — CID 87888655
[4-[4-[(E)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(7-chloro-6-methylquinolin-2-yl)methanone (PubChem CID 87888655) has the molecular formula C31H36BrClN4O2 and a molecular weight of 612.01 g/mol. Its IUPAC name is [4-[4-[(E)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(7-chloro-6-methylquinolin-2-yl)methanone.
| Compound Name | [4-[4-[(E)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(7-chloro-6-methylquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 87888655 |
| Molecular Formula | C31H36BrClN4O2 |
| Molecular Weight | 612.01 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | [4-[4-[(E)-C-(4-bromophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]-4-methylpiperidin-1-yl]-(7-chloro-6-methylquinolin-2-yl)methanone |
| SMILES | CCO/N=C(/c1ccc(Br)cc1)C1CCN(C2(C)CCN(C(=O)c3ccc4cc(C)c(Cl)cc4n3)CC2)CC1 |
| InChI | InChI=1S/C31H36BrClN4O2/c1-4-39-35-29(22-5-8-25(32)9-6-22)23-11-15-37(16-12-23)31(3)13-17-36(18-14-31)30(38)27-10-7-24-19-21(2)26(33)20-28(24)34-27/h5-10,19-20,23H,4,11-18H2,1-3H3/b35-29- |
| InChIKey | CHIBQCCTTNKFKR-MJPNWULPSA-N |
| XLogP | 7.11 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.01 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|