C25H31BrCl2N4O2 — CID 177396582
(Z)-1-(4-bromophenyl)-1-[1-[1-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-4-methylpiperidin-4-yl]piperidin-4-yl]-N-ethoxymethanimine (PubChem CID 177396582) has the molecular formula C25H31BrCl2N4O2 and a molecular weight of 570.36 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-1-[1-[1-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-4-methylpiperidin-4-yl]piperidin-4-yl]-N-ethoxymethanimine.
| Compound Name | (Z)-1-(4-bromophenyl)-1-[1-[1-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-4-methylpiperidin-4-yl]piperidin-4-yl]-N-ethoxymethanimine |
|---|---|
| PubChem CID | 177396582 |
| Molecular Formula | C25H31BrCl2N4O2 |
| Molecular Weight | 570.36 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-1-[1-[1-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-4-methylpiperidin-4-yl]piperidin-4-yl]-N-ethoxymethanimine |
| SMILES | CCO/N=C(\c1ccc(Br)cc1)C1CCN(C2(C)CCN(c3c(Cl)c[n+]([O-])cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C25H31BrCl2N4O2/c1-3-34-29-23(18-4-6-20(26)7-5-18)19-8-12-31(13-9-19)25(2)10-14-30(15-11-25)24-21(27)16-32(33)17-22(24)28/h4-7,16-17,19H,3,8-15H2,1-2H3/b29-23+ |
| InChIKey | SJGLDOFVVJXQIM-BYNJWEBRSA-N |
| XLogP | 5.90 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|