C22H28N6O4 — CID 163862588
tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-N-[4-(N'-hydroxycarbamimidoyl)phenyl]anilino]azetidine-1-carboxylate (PubChem CID 163862588) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-N-[4-(N'-hydroxycarbamimidoyl)phenyl]anilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-N-[4-(N'-hydroxycarbamimidoyl)phenyl]anilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163862588 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | tert-butyl 3-[4-(N'-hydroxycarbamimidoyl)-N-[4-(N'-hydroxycarbamimidoyl)phenyl]anilino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N(c2ccc(C(N)=NO)cc2)c2ccc(C(N)=NO)cc2)C1 |
| InChI | InChI=1S/C22H28N6O4/c1-22(2,3)32-21(29)27-12-18(13-27)28(16-8-4-14(5-9-16)19(23)25-30)17-10-6-15(7-11-17)20(24)26-31/h4-11,18,30-31H,12-13H2,1-3H3,(H2,23,25)(H2,24,26) |
| InChIKey | PDVYBDFHZXHTDF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|