C23H28N4O4 — CID 59809556
tert-butyl 4-[3-[(Z)-N'-hydroxycarbamimidoyl]phenoxazin-10-yl]piperidine-1-carboxylate (PubChem CID 59809556) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl 4-[3-[(Z)-N'-hydroxycarbamimidoyl]phenoxazin-10-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(Z)-N'-hydroxycarbamimidoyl]phenoxazin-10-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59809556 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl 4-[3-[(Z)-N'-hydroxycarbamimidoyl]phenoxazin-10-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2c3ccccc3Oc3cc(/C(N)=N/O)ccc32)CC1 |
| InChI | InChI=1S/C23H28N4O4/c1-23(2,3)31-22(28)26-12-10-16(11-13-26)27-17-6-4-5-7-19(17)30-20-14-15(21(24)25-29)8-9-18(20)27/h4-9,14,16,29H,10-13H2,1-3H3,(H2,24,25) |
| InChIKey | ACYJPGVJEVYQCE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|