C22H26N2O5 — CID 175198783
tert-butyl (3R,4R,5R)-3,4-dihydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate (PubChem CID 175198783) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl (3R,4R,5R)-3,4-dihydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R,5R)-3,4-dihydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175198783 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl (3R,4R,5R)-3,4-dihydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)[C@H](O)[C@H](N2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2,3)29-21(27)23-12-16(20(26)17(25)13-23)24-14-8-4-6-10-18(14)28-19-11-7-5-9-15(19)24/h4-11,16-17,20,25-26H,12-13H2,1-3H3/t16-,17-,20-/m1/s1 |
| InChIKey | PGOVTERRHCGGRM-MBOZVWFJSA-N |
| XLogP | 3.27 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |