C22H25N5O4 — CID 126673544
tert-butyl 3-azido-4-hydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate (PubChem CID 126673544) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is tert-butyl 3-azido-4-hydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-azido-4-hydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126673544 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | tert-butyl 3-azido-4-hydroxy-5-phenoxazin-10-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N=[N+]=[N-])C(O)C(N2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C22H25N5O4/c1-22(2,3)31-21(29)26-12-14(24-25-23)20(28)17(13-26)27-15-8-4-6-10-18(15)30-19-11-7-5-9-16(19)27/h4-11,14,17,20,28H,12-13H2,1-3H3 |
| InChIKey | OJIQPIZDZGOANN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|