C22H27N3O3 — CID 135315584
tert-butyl (3S,4S,5S)-3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylate (PubChem CID 135315584) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl (3S,4S,5S)-3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S,5S)-3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 135315584 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl (3S,4S,5S)-3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N)[C@H](O)[C@@H](n2c3ccccc3c3ccccc32)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(2,3)28-21(27)24-12-16(23)20(26)19(13-24)25-17-10-6-4-8-14(17)15-9-5-7-11-18(15)25/h4-11,16,19-20,26H,12-13,23H2,1-3H3/t16-,19-,20-/m0/s1 |
| InChIKey | HICGNRWGSYNMTA-VDGAXYAQSA-N |
| XLogP | 3.27 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |