C18H19N3O3 — CID 126673582
3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylic acid (PubChem CID 126673582) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126673582 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-amino-5-carbazol-9-yl-4-hydroxypiperidine-1-carboxylic acid |
| SMILES | NC1CN(C(=O)O)CC(n2c3ccccc3c3ccccc32)C1O |
| InChI | InChI=1S/C18H19N3O3/c19-13-9-20(18(23)24)10-16(17(13)22)21-14-7-3-1-5-11(14)12-6-2-4-8-15(12)21/h1-8,13,16-17,22H,9-10,19H2,(H,23,24) |
| InChIKey | TZHZKLLQPSOPAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |