C18H20N2O — CID 123469033
2-amino-6-carbazol-9-ylcyclohexan-1-ol (PubChem CID 123469033) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-6-carbazol-9-ylcyclohexan-1-ol.
| Compound Name | 2-amino-6-carbazol-9-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123469033 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-amino-6-carbazol-9-ylcyclohexan-1-ol |
| SMILES | NC1CCCC(n2c3ccccc3c3ccccc32)C1O |
| InChI | InChI=1S/C18H20N2O/c19-14-8-5-11-17(18(14)21)20-15-9-3-1-6-12(15)13-7-2-4-10-16(13)20/h1-4,6-7,9-10,14,17-18,21H,5,8,11,19H2 |
| InChIKey | NZTIJJXAOOMSPJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |