C25H27N3O2S — CID 166592581
2-carbazol-9-yl-6-[(N-methyl-S-phenylsulfonimidoyl)amino]cyclohexan-1-ol (PubChem CID 166592581) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[(N-methyl-S-phenylsulfonimidoyl)amino]cyclohexan-1-ol.
| Compound Name | 2-carbazol-9-yl-6-[(N-methyl-S-phenylsulfonimidoyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166592581 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-carbazol-9-yl-6-[(N-methyl-S-phenylsulfonimidoyl)amino]cyclohexan-1-ol |
| SMILES | CN=S(=O)(NC1CCCC(n2c3ccccc3c3ccccc32)C1O)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O2S/c1-26-31(30,18-10-3-2-4-11-18)27-21-14-9-17-24(25(21)29)28-22-15-7-5-12-19(22)20-13-6-8-16-23(20)28/h2-8,10-13,15-16,21,24-25,29H,9,14,17H2,1H3,(H,26,27,30) |
| InChIKey | CUIADGZSQRYIJF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |