C19H21NO2 — CID 140895217
cis-(1R,2S)-3-carbazol-9-ylcycloheptane-1,2-diol (PubChem CID 140895217) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is cis-(1R,2S)-3-carbazol-9-ylcycloheptane-1,2-diol.
| Compound Name | cis-(1R,2S)-3-carbazol-9-ylcycloheptane-1,2-diol |
|---|---|
| PubChem CID | 140895217 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | cis-(1R,2S)-3-carbazol-9-ylcycloheptane-1,2-diol |
| SMILES | O[C@@H]1CCCCC(n2c3ccccc3c3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C19H21NO2/c21-18-12-6-5-11-17(19(18)22)20-15-9-3-1-7-13(15)14-8-2-4-10-16(14)20/h1-4,7-10,17-19,21-22H,5-6,11-12H2/t17?,18-,19+/m1/s1 |
| InChIKey | MAVMQAZCPNXSSN-CPSIJMPNSA-N |
| XLogP | 3.63 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |