About 9-cyclononylcarbazole
9-cyclononylcarbazole (PubChem CID 139570160) has the molecular formula C21H25N
and a molecular weight of 291.44 g/mol. Its IUPAC name is 9-cyclononylcarbazole.
Molecular Properties
| Compound Name | 9-cyclononylcarbazole |
| PubChem CID | 139570160 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 9-cyclononylcarbazole |
| SMILES | c1ccc2c(c1)c1ccccc1n2C1CCCCCCCC1 |
| InChI | InChI=1S/C21H25N/c1-2-4-6-12-17(11-5-3-1)22-20-15-9-7-13-18(20)19-14-8-10-16-21(19)22/h7-10,13-17H,1-6,11-12H2 |
| InChIKey | DOIUUTNBIZBWGG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-cyclononylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclononylcarbazole?
The IUPAC name of 9-cyclononylcarbazole (CID 139570160) is 9-cyclononylcarbazole.
What is the SMILES notation for 9-cyclononylcarbazole?
The canonical SMILES for 9-cyclononylcarbazole is c1ccc2c(c1)c1ccccc1n2C1CCCCCCCC1.
What is the InChIKey of 9-cyclononylcarbazole?
The InChIKey is DOIUUTNBIZBWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N/c1-2-4-6-12-17(11-5-3-1)22-20-15-9-7-13-18(20)19-14-8-10-16-21(19)22/h7-10,13-17H,1-6,11-12H2.
What are the key properties of 9-cyclononylcarbazole?
9-cyclononylcarbazole has a molecular weight of 291.44 g/mol, XLogP of 6.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclononylcarbazole is sourced from PubChem (CID 139570160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).