C18H18N4O — CID 134238564
trans-(1S,6R)-2-azido-6-carbazol-9-ylcyclohexan-1-ol (PubChem CID 134238564) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is trans-(1S,6R)-2-azido-6-carbazol-9-ylcyclohexan-1-ol.
| Compound Name | trans-(1S,6R)-2-azido-6-carbazol-9-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134238564 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | trans-(1S,6R)-2-azido-6-carbazol-9-ylcyclohexan-1-ol |
| SMILES | [N-]=[N+]=NC1CCC[C@@H](n2c3ccccc3c3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C18H18N4O/c19-21-20-14-8-5-11-17(18(14)23)22-15-9-3-1-6-12(15)13-7-2-4-10-16(13)22/h1-4,6-7,9-10,14,17-18,23H,5,8,11H2/t14?,17-,18-/m1/s1 |
| InChIKey | AUMFYPDQRUXNRJ-KNHHTTPFSA-N |
| XLogP | 4.56 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|