About trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol
trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol (PubChem CID 166831954) has the molecular formula C13H14FN5O
and a molecular weight of 275.29 g/mol. Its IUPAC name is trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol |
| PubChem CID | 166831954 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol |
| SMILES | [N-]=[N+]=NC1CCC[C@H](n2cc3c(F)cccc3n2)[C@H]1O |
| InChI | InChI=1S/C13H14FN5O/c14-9-3-1-4-10-8(9)7-19(17-10)12-6-2-5-11(13(12)20)16-18-15/h1,3-4,7,11-13,20H,2,5-6H2/t11?,12-,13-/m0/s1 |
| InChIKey | SQWXWYZVCQRMJF-SPOOISQMSA-N |
| XLogP | 2.94 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol (CID 166831954) is trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol is [N-]=[N+]=NC1CCC[C@H](n2cc3c(F)cccc3n2)[C@H]1O.
What is the InChIKey of trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol?
The InChIKey is SQWXWYZVCQRMJF-SPOOISQMSA-N. The full InChI is InChI=1S/C13H14FN5O/c14-9-3-1-4-10-8(9)7-19(17-10)12-6-2-5-11(13(12)20)16-18-15/h1,3-4,7,11-13,20H,2,5-6H2/t11?,12-,13-/m0/s1.
What are the key properties of trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol?
trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol has a molecular weight of 275.29 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,6S)-2-azido-6-(4-fluoroindazol-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 166831954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).