C20H21FN4O — CID 134402307
trans-(1S,6R)-2-azido-6-(3-fluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)cyclohexan-1-ol (PubChem CID 134402307) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is trans-(1S,6R)-2-azido-6-(3-fluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,6R)-2-azido-6-(3-fluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 134402307 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | trans-(1S,6R)-2-azido-6-(3-fluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)cyclohexan-1-ol |
| SMILES | [N-]=[N+]=NC1CCC[C@@H](N2c3ccccc3CCc3cc(F)ccc32)[C@@H]1O |
| InChI | InChI=1S/C20H21FN4O/c21-15-10-11-18-14(12-15)9-8-13-4-1-2-6-17(13)25(18)19-7-3-5-16(20(19)26)23-24-22/h1-2,4,6,10-12,16,19-20,26H,3,5,7-9H2/t16?,19-,20-/m1/s1 |
| InChIKey | TWWYGANAYODXDU-ODFWGIBRSA-N |
| XLogP | 4.65 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|