C19H18F2N4O3S — CID 140905142
(3S,4R,5R)-3-azido-5-(3,8-difluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1,1-dioxothian-4-ol (PubChem CID 140905142) has the molecular formula C19H18F2N4O3S and a molecular weight of 420.44 g/mol. Its IUPAC name is (3S,4R,5R)-3-azido-5-(3,8-difluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1,1-dioxothian-4-ol.
| Compound Name | (3S,4R,5R)-3-azido-5-(3,8-difluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 140905142 |
| Molecular Formula | C19H18F2N4O3S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (3S,4R,5R)-3-azido-5-(3,8-difluoro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1,1-dioxothian-4-ol |
| SMILES | [N-]=[N+]=N[C@@H]1CS(=O)(=O)C[C@H](N2c3ccc(F)cc3CCc3cc(F)ccc32)[C@H]1O |
| InChI | InChI=1S/C19H18F2N4O3S/c20-13-3-5-16-11(7-13)1-2-12-8-14(21)4-6-17(12)25(16)18-10-29(27,28)9-15(19(18)26)23-24-22/h3-8,15,18-19,26H,1-2,9-10H2/t15-,18+,19+/m1/s1 |
| InChIKey | WZUKTAMDJJBIHY-MNEFBYGVSA-N |
| XLogP | 3.04 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|