C17H23ClN4 — CID 58607056
1-[(1S,2R)-2-azidocyclopentyl]-4-[(4-chlorophenyl)methyl]piperidine (PubChem CID 58607056) has the molecular formula C17H23ClN4 and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[(1S,2R)-2-azidocyclopentyl]-4-[(4-chlorophenyl)methyl]piperidine.
| Compound Name | 1-[(1S,2R)-2-azidocyclopentyl]-4-[(4-chlorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 58607056 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[(1S,2R)-2-azidocyclopentyl]-4-[(4-chlorophenyl)methyl]piperidine |
| SMILES | [N-]=[N+]=N[C@@H]1CCC[C@@H]1N1CCC(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN4/c18-15-6-4-13(5-7-15)12-14-8-10-22(11-9-14)17-3-1-2-16(17)20-21-19/h4-7,14,16-17H,1-3,8-12H2/t16-,17+/m1/s1 |
| InChIKey | AJIISAARSGPFQN-SJORKVTESA-N |
| XLogP | 4.83 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|