C16H22ClNO2 — CID 23587608
(3R,4S)-4-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]oxolan-3-ol (PubChem CID 23587608) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (3R,4S)-4-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]oxolan-3-ol.
| Compound Name | (3R,4S)-4-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 23587608 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (3R,4S)-4-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]oxolan-3-ol |
| SMILES | O[C@H]1COC[C@@H]1N1CCC(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClNO2/c17-14-3-1-12(2-4-14)9-13-5-7-18(8-6-13)15-10-20-11-16(15)19/h1-4,13,15-16,19H,5-11H2/t15-,16-/m0/s1 |
| InChIKey | BGKXORBNYPNIKB-HOTGVXAUSA-N |
| XLogP | 2.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |