C24H21Cl3N2O3S — CID 155061442
4-chloro-N-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 155061442) has the molecular formula C24H21Cl3N2O3S and a molecular weight of 523.87 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155061442 |
| Molecular Formula | C24H21Cl3N2O3S |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 4-chloro-N-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC(n2c3ccc(Cl)cc3c3cc(Cl)ccc32)[C@H]1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21Cl3N2O3S/c25-14-4-8-17(9-5-14)33(31,32)28-20-2-1-3-23(24(20)30)29-21-10-6-15(26)12-18(21)19-13-16(27)7-11-22(19)29/h4-13,20,23-24,28,30H,1-3H2/t20?,23?,24-/m0/s1 |
| InChIKey | DSTMXQOXYXDUJL-BOYUCYPVSA-N |
| XLogP | 6.19 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |