C16H23ClN2O3S — CID 1167612
4-chloro-N-[(1S,2R)-2-morpholin-4-ylcyclohexyl]benzenesulfonamide (PubChem CID 1167612) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is 4-chloro-N-[(1S,2R)-2-morpholin-4-ylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1S,2R)-2-morpholin-4-ylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1167612 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-chloro-N-[(1S,2R)-2-morpholin-4-ylcyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@H]1N1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClN2O3S/c17-13-5-7-14(8-6-13)23(20,21)18-15-3-1-2-4-16(15)19-9-11-22-12-10-19/h5-8,15-16,18H,1-4,9-12H2/t15-,16+/m0/s1 |
| InChIKey | AYQCZQKMGKDZPS-JKSUJKDBSA-N |
| XLogP | 2.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |