C17H27N3O2S — CID 23604938
N-[2-(4-methylpiperazin-1-yl)cyclohexyl]benzenesulfonamide (PubChem CID 23604938) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)cyclohexyl]benzenesulfonamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23604938 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)cyclohexyl]benzenesulfonamide |
| SMILES | CN1CCN(C2CCCCC2NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3O2S/c1-19-11-13-20(14-12-19)17-10-6-5-9-16(17)18-23(21,22)15-7-3-2-4-8-15/h2-4,7-8,16-18H,5-6,9-14H2,1H3 |
| InChIKey | ZVYXEYXGYWDUEV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |