C22H28ClN3O2S — CID 94784679
N-[(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexyl]benzenesulfonamide (PubChem CID 94784679) has the molecular formula C22H28ClN3O2S and a molecular weight of 434.01 g/mol. Its IUPAC name is N-[(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexyl]benzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94784679 |
| Molecular Formula | C22H28ClN3O2S |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(1S,2S)-2-[4-(3-chlorophenyl)piperazin-1-yl]cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1N1CCN(c2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClN3O2S/c23-18-7-6-8-19(17-18)25-13-15-26(16-14-25)22-12-5-4-11-21(22)24-29(27,28)20-9-2-1-3-10-20/h1-3,6-10,17,21-22,24H,4-5,11-16H2/t21-,22-/m0/s1 |
| InChIKey | MBKJPVCOWJBZMX-VXKWHMMOSA-N |
| XLogP | 3.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |