C11H13BrClNO2S — CID 80661956
N-(2-bromocyclopentyl)-3-chlorobenzenesulfonamide (PubChem CID 80661956) has the molecular formula C11H13BrClNO2S and a molecular weight of 338.65 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-3-chlorobenzenesulfonamide.
| Compound Name | N-(2-bromocyclopentyl)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 80661956 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | N-(2-bromocyclopentyl)-3-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1Br)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13BrClNO2S/c12-10-5-2-6-11(10)14-17(15,16)9-4-1-3-8(13)7-9/h1,3-4,7,10-11,14H,2,5-6H2 |
| InChIKey | TVUSYXHKDOKMLR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|