C12H14BrCl2NO2S — CID 114297364
N-(2-bromocyclohexyl)-3,5-dichlorobenzenesulfonamide (PubChem CID 114297364) has the molecular formula C12H14BrCl2NO2S and a molecular weight of 387.13 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(2-bromocyclohexyl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114297364 |
| Molecular Formula | C12H14BrCl2NO2S |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | N-(2-bromocyclohexyl)-3,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1Br)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14BrCl2NO2S/c13-11-3-1-2-4-12(11)16-19(17,18)10-6-8(14)5-9(15)7-10/h5-7,11-12,16H,1-4H2 |
| InChIKey | MWMKOXCCHKGQFN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|