C17H26ClN2O2S+ — CID 6972183
4-chloro-N-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]benzenesulfonamide (PubChem CID 6972183) has the molecular formula C17H26ClN2O2S+ and a molecular weight of 357.93 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6972183 |
| Molecular Formula | C17H26ClN2O2S+ |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCC[C@H]1[NH+]1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H25ClN2O2S/c18-14-8-10-15(11-9-14)23(21,22)19-16-6-2-3-7-17(16)20-12-4-1-5-13-20/h8-11,16-17,19H,1-7,12-13H2/p+1/t16-,17-/m1/s1 |
| InChIKey | PMWATPIHTAPIBJ-IAGOWNOFSA-O |
| XLogP | 2.00 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |