C26H26N4O2S — CID 166592631
4-[S-[(3-carbazol-9-yl-2-hydroxycyclohexyl)amino]-N-methylsulfonimidoyl]benzonitrile (PubChem CID 166592631) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 4-[S-[(3-carbazol-9-yl-2-hydroxycyclohexyl)amino]-N-methylsulfonimidoyl]benzonitrile.
| Compound Name | 4-[S-[(3-carbazol-9-yl-2-hydroxycyclohexyl)amino]-N-methylsulfonimidoyl]benzonitrile |
|---|---|
| PubChem CID | 166592631 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[S-[(3-carbazol-9-yl-2-hydroxycyclohexyl)amino]-N-methylsulfonimidoyl]benzonitrile |
| SMILES | CN=S(=O)(NC1CCCC(n2c3ccccc3c3ccccc32)C1O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H26N4O2S/c1-28-33(32,19-15-13-18(17-27)14-16-19)29-22-9-6-12-25(26(22)31)30-23-10-4-2-7-20(23)21-8-3-5-11-24(21)30/h2-5,7-8,10-11,13-16,22,25-26,31H,6,9,12H2,1H3,(H,28,29,32) |
| InChIKey | UKKPWIBOEXAPIH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |