C25H25N3O3S — CID 126674416
4-cyano-N-[(1S,2S,3R)-2-hydroxy-3-(N-phenylanilino)cyclohexyl]benzenesulfonamide (PubChem CID 126674416) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-cyano-N-[(1S,2S,3R)-2-hydroxy-3-(N-phenylanilino)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(1S,2S,3R)-2-hydroxy-3-(N-phenylanilino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126674416 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-cyano-N-[(1S,2S,3R)-2-hydroxy-3-(N-phenylanilino)cyclohexyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N[C@H]2CCC[C@@H](N(c3ccccc3)c3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c26-18-19-14-16-22(17-15-19)32(30,31)27-23-12-7-13-24(25(23)29)28(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,14-17,23-25,27,29H,7,12-13H2/t23-,24+,25+/m0/s1 |
| InChIKey | UDVWZLYRJHMBTG-ISJGIBHGSA-N |
| XLogP | 3.96 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |