C19H27N3O5 — CID 91332370
tert-butyl 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 91332370) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91332370 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | tert-butyl 2-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)CC1CC(c2ccc(C(N)=NO)cc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H27N3O5/c1-19(2,3)27-18(24)22-11-12(10-16(23)26-4)9-15(22)13-5-7-14(8-6-13)17(20)21-25/h5-8,12,15,25H,9-11H2,1-4H3,(H2,20,21) |
| InChIKey | GYSBQBSHCRHBOV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|