C18H24N6O4 — CID 142772821
tert-butyl (3S)-3-[[6-[(Z)-N'-hydroxycarbamimidoyl]imidazo[1,2-a]pyridin-2-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 142772821) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-[(Z)-N'-hydroxycarbamimidoyl]imidazo[1,2-a]pyridin-2-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[6-[(Z)-N'-hydroxycarbamimidoyl]imidazo[1,2-a]pyridin-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142772821 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | tert-butyl (3S)-3-[[6-[(Z)-N'-hydroxycarbamimidoyl]imidazo[1,2-a]pyridin-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C(=O)Nc2cn3cc(/C(N)=N/O)ccc3n2)C1 |
| InChI | InChI=1S/C18H24N6O4/c1-18(2,3)28-17(26)23-7-6-12(9-23)16(25)21-13-10-24-8-11(15(19)22-27)4-5-14(24)20-13/h4-5,8,10,12,27H,6-7,9H2,1-3H3,(H2,19,22)(H,21,25)/t12-/m0/s1 |
| InChIKey | HYYRXXOUECUGBC-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|