C10H17N3O4 — CID 175135124
tert-butyl 3-(nitrosocarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 175135124) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is tert-butyl 3-(nitrosocarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(nitrosocarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175135124 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | tert-butyl 3-(nitrosocarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NN=O)C1 |
| InChI | InChI=1S/C10H17N3O4/c1-10(2,3)17-9(15)13-5-4-7(6-13)8(14)11-12-16/h7H,4-6H2,1-3H3,(H,11,14,16) |
| InChIKey | VKDVFYLIZCMTNA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|