C15H26N2O3 — CID 139580386
tert-butyl 3-[(E)-3-(dimethylamino)but-2-enoyl]pyrrolidine-1-carboxylate (PubChem CID 139580386) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-(dimethylamino)but-2-enoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-3-(dimethylamino)but-2-enoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139580386 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl 3-[(E)-3-(dimethylamino)but-2-enoyl]pyrrolidine-1-carboxylate |
| SMILES | C/C(=C\C(=O)C1CCN(C(=O)OC(C)(C)C)C1)N(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-11(16(5)6)9-13(18)12-7-8-17(10-12)14(19)20-15(2,3)4/h9,12H,7-8,10H2,1-6H3/b11-9+ |
| InChIKey | KFYTWMIFVYMEJB-PKNBQFBNSA-N |
| XLogP | 2.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|