C14H19N3O4S — CID 118980438
tert-butyl 3-[(5-formyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 118980438) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is tert-butyl 3-[(5-formyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-formyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118980438 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | tert-butyl 3-[(5-formyl-1,3-thiazol-2-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ncc(C=O)s2)C1 |
| InChI | InChI=1S/C14H19N3O4S/c1-14(2,3)21-13(20)17-5-4-9(7-17)11(19)16-12-15-6-10(8-18)22-12/h6,8-9H,4-5,7H2,1-3H3,(H,15,16,19) |
| InChIKey | FLSNMYDLDBQGSJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|