C17H21N3O3S — CID 174379920
tert-butyl 3-(1,2-benzothiazol-5-ylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 174379920) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is tert-butyl 3-(1,2-benzothiazol-5-ylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,2-benzothiazol-5-ylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174379920 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | tert-butyl 3-(1,2-benzothiazol-5-ylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ccc3sncc3c2)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-17(2,3)23-16(22)20-7-6-11(10-20)15(21)19-13-4-5-14-12(8-13)9-18-24-14/h4-5,8-9,11H,6-7,10H2,1-3H3,(H,19,21) |
| InChIKey | ORSRDNQLYPTZES-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |