C21H29N3O3 — CID 97177316
tert-butyl (3S)-3-[(4-cyanophenyl)methyl-ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 97177316) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(4-cyanophenyl)methyl-ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(4-cyanophenyl)methyl-ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97177316 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl (3S)-3-[(4-cyanophenyl)methyl-ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCN(Cc1ccc(C#N)cc1)C(=O)[C@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H29N3O3/c1-5-23(14-17-10-8-16(13-22)9-11-17)19(25)18-7-6-12-24(15-18)20(26)27-21(2,3)4/h8-11,18H,5-7,12,14-15H2,1-4H3/t18-/m0/s1 |
| InChIKey | IGTXGZRKHSKRRD-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |