C21H31FN2O3 — CID 71632883
tert-butyl 4-[(2-fluorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate (PubChem CID 71632883) has the molecular formula C21H31FN2O3 and a molecular weight of 378.49 g/mol. Its IUPAC name is tert-butyl 4-[(2-fluorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-fluorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71632883 |
| Molecular Formula | C21H31FN2O3 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tert-butyl 4-[(2-fluorophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)N(Cc1ccccc1F)C(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31FN2O3/c1-15(2)24(14-17-8-6-7-9-18(17)22)19(25)16-10-12-23(13-11-16)20(26)27-21(3,4)5/h6-9,15-16H,10-14H2,1-5H3 |
| InChIKey | ZBWIXOSVMWEXPY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |