C23H26N2O3 — CID 121473867
tert-butyl 3-(6-cyano-5-methylnaphthalene-2-carbonyl)piperidine-1-carboxylate (PubChem CID 121473867) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl 3-(6-cyano-5-methylnaphthalene-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(6-cyano-5-methylnaphthalene-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121473867 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | tert-butyl 3-(6-cyano-5-methylnaphthalene-2-carbonyl)piperidine-1-carboxylate |
| SMILES | Cc1c(C#N)ccc2cc(C(=O)C3CCCN(C(=O)OC(C)(C)C)C3)ccc12 |
| InChI | InChI=1S/C23H26N2O3/c1-15-18(13-24)8-7-16-12-17(9-10-20(15)16)21(26)19-6-5-11-25(14-19)22(27)28-23(2,3)4/h7-10,12,19H,5-6,11,14H2,1-4H3 |
| InChIKey | ZXLQAQIFVZRFGO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |