C21H28N2O4 — CID 46612716
tert-butyl 4-[1-(1-benzofuran-2-yl)ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 46612716) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 4-[1-(1-benzofuran-2-yl)ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(1-benzofuran-2-yl)ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46612716 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl 4-[1-(1-benzofuran-2-yl)ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(NC(=O)C1CCN(C(=O)OC(C)(C)C)CC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H28N2O4/c1-14(18-13-16-7-5-6-8-17(16)26-18)22-19(24)15-9-11-23(12-10-15)20(25)27-21(2,3)4/h5-8,13-15H,9-12H2,1-4H3,(H,22,24) |
| InChIKey | UUZXMUPXIFHFLA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |