C20H28N4O3 — CID 39966598
tert-butyl 4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 39966598) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39966598 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | tert-butyl 4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](NC(=O)C1CCN(C(=O)OC(C)(C)C)CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H28N4O3/c1-13(17-22-15-7-5-6-8-16(15)23-17)21-18(25)14-9-11-24(12-10-14)19(26)27-20(2,3)4/h5-8,13-14H,9-12H2,1-4H3,(H,21,25)(H,22,23)/t13-/m1/s1 |
| InChIKey | FPBAPZFRZKMKJO-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |