C18H25NO3 — CID 16663835
tert-butyl N-[(1S)-1-(1-benzofuran-2-yl)-3-methylbutyl]carbamate (PubChem CID 16663835) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(1-benzofuran-2-yl)-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(1-benzofuran-2-yl)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 16663835 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl N-[(1S)-1-(1-benzofuran-2-yl)-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H25NO3/c1-12(2)10-14(19-17(20)22-18(3,4)5)16-11-13-8-6-7-9-15(13)21-16/h6-9,11-12,14H,10H2,1-5H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | AFLMEAONCLPLKM-AWEZNQCLSA-N |
| XLogP | 5.04 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |