C22H24N2O4S — CID 56839230
tert-butyl 2-[2-[(4-methylphenyl)sulfonylamino]phenyl]pyrrole-1-carboxylate (PubChem CID 56839230) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[(4-methylphenyl)sulfonylamino]phenyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(4-methylphenyl)sulfonylamino]phenyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 56839230 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | tert-butyl 2-[2-[(4-methylphenyl)sulfonylamino]phenyl]pyrrole-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2-c2cccn2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-16-11-13-17(14-12-16)29(26,27)23-19-9-6-5-8-18(19)20-10-7-15-24(20)21(25)28-22(2,3)4/h5-15,23H,1-4H3 |
| InChIKey | LQYMIGQPNKSCIH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |