C22H19ClN6O3S — CID 1463812
2-[5-[2-[(4-chlorophenyl)sulfonylamino]phenyl]tetrazol-2-yl]-N-(4-methylphenyl)acetamide (PubChem CID 1463812) has the molecular formula C22H19ClN6O3S and a molecular weight of 482.95 g/mol. Its IUPAC name is 2-[5-[2-[(4-chlorophenyl)sulfonylamino]phenyl]tetrazol-2-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-[2-[(4-chlorophenyl)sulfonylamino]phenyl]tetrazol-2-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1463812 |
| Molecular Formula | C22H19ClN6O3S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 2-[5-[2-[(4-chlorophenyl)sulfonylamino]phenyl]tetrazol-2-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nnc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C22H19ClN6O3S/c1-15-6-10-17(11-7-15)24-21(30)14-29-26-22(25-28-29)19-4-2-3-5-20(19)27-33(31,32)18-12-8-16(23)9-13-18/h2-13,27H,14H2,1H3,(H,24,30) |
| InChIKey | PSYYEEIEJRLWCJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |