C22H18N6O2 — CID 1455558
N-[2-[2-(2-anilino-2-oxoethyl)tetrazol-5-yl]phenyl]benzamide (PubChem CID 1455558) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[2-[2-(2-anilino-2-oxoethyl)tetrazol-5-yl]phenyl]benzamide.
| Compound Name | N-[2-[2-(2-anilino-2-oxoethyl)tetrazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 1455558 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[2-[2-(2-anilino-2-oxoethyl)tetrazol-5-yl]phenyl]benzamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2NC(=O)c2ccccc2)n1)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N6O2/c29-20(23-17-11-5-2-6-12-17)15-28-26-21(25-27-28)18-13-7-8-14-19(18)24-22(30)16-9-3-1-4-10-16/h1-14H,15H2,(H,23,29)(H,24,30) |
| InChIKey | OOUOKIXLTJXJEI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |