C17H14N6O4 — CID 5151774
2-[[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]carbamoyl]benzoic acid (PubChem CID 5151774) has the molecular formula C17H14N6O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-[[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 5151774 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]carbamoyl]benzoic acid |
| SMILES | NC(=O)Cn1nnc(-c2ccccc2NC(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C17H14N6O4/c18-14(24)9-23-21-15(20-22-23)12-7-3-4-8-13(12)19-16(25)10-5-1-2-6-11(10)17(26)27/h1-8H,9H2,(H2,18,24)(H,19,25)(H,26,27) |
| InChIKey | XLHKWVGFIVFFDB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |