C17H16N6O2 — CID 858288
N-[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]-3-methylbenzamide (PubChem CID 858288) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]-3-methylbenzamide.
| Compound Name | N-[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 858288 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[2-[2-(2-amino-2-oxoethyl)tetrazol-5-yl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2-c2nnn(CC(N)=O)n2)c1 |
| InChI | InChI=1S/C17H16N6O2/c1-11-5-4-6-12(9-11)17(25)19-14-8-3-2-7-13(14)16-20-22-23(21-16)10-15(18)24/h2-9H,10H2,1H3,(H2,18,24)(H,19,25) |
| InChIKey | CUNPEPCAMMTFIU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |