C17H16IN5O — CID 3644769
N-(4-iodo-2-methylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide (PubChem CID 3644769) has the molecular formula C17H16IN5O and a molecular weight of 433.25 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3644769 |
| Molecular Formula | C17H16IN5O |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[5-(2-methylphenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)Cn1nnc(-c2ccccc2C)n1 |
| InChI | InChI=1S/C17H16IN5O/c1-11-5-3-4-6-14(11)17-20-22-23(21-17)10-16(24)19-15-8-7-13(18)9-12(15)2/h3-9H,10H2,1-2H3,(H,19,24) |
| InChIKey | HRSPZMZXKIHBCW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|