C24H22N6O3 — CID 2511451
N-(2-methoxyphenyl)-4-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]benzamide (PubChem CID 2511451) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2511451 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)Cn2nnc(-c3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C24H22N6O3/c1-16-7-3-4-8-19(16)23-27-29-30(28-23)15-22(31)25-18-13-11-17(12-14-18)24(32)26-20-9-5-6-10-21(20)33-2/h3-14H,15H2,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | SIKOYXQNCGSHGV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |