C23H19ClN6O2 — CID 22300953
N-[2-[2-[2-amino-1-(4-methylphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-chlorobenzamide (PubChem CID 22300953) has the molecular formula C23H19ClN6O2 and a molecular weight of 446.90 g/mol. Its IUPAC name is N-[2-[2-[2-amino-1-(4-methylphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-chlorobenzamide.
| Compound Name | N-[2-[2-[2-amino-1-(4-methylphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 22300953 |
| Molecular Formula | C23H19ClN6O2 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[2-[2-[2-amino-1-(4-methylphenyl)-2-oxoethyl]tetrazol-5-yl]phenyl]-3-chlorobenzamide |
| SMILES | Cc1ccc(C(C(N)=O)n2nnc(-c3ccccc3NC(=O)c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C23H19ClN6O2/c1-14-9-11-15(12-10-14)20(21(25)31)30-28-22(27-29-30)18-7-2-3-8-19(18)26-23(32)16-5-4-6-17(24)13-16/h2-13,20H,1H3,(H2,25,31)(H,26,32) |
| InChIKey | KIDYCNFEPHMNQP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |