C20H21ClN6O2 — CID 42016506
4-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 42016506) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 4-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 42016506 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-[[2-[5-(4-chlorophenyl)tetrazol-2-yl]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cn2nnc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C20H21ClN6O2/c1-3-26(4-2)20(29)15-7-11-17(12-8-15)22-18(28)13-27-24-19(23-25-27)14-5-9-16(21)10-6-14/h5-12H,3-4,13H2,1-2H3,(H,22,28) |
| InChIKey | RDWNCXMQAWYZDP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |